CAS 234432-85-0 is the registry number for PCB No. 1 13C12 40 µg/mL in Isooctane. Offered by: Dr. Ehrenstorfer. Available pack sizes: 5ml, 1ml.
1-chloro-6-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 234432-85-0) is a chemical compound with the molecular formula C12H9Cl and a molecular weight of 200.56 g/mol. IUPAC name: 1-chloro-6-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: LAXBNTIAOJWAOP-WCGVKTIYSA-N.
| Molecular formula | C12H9Cl |
|---|---|
| Molecular weight | 200.56 g/mol |
| IUPAC name | 1-chloro-6-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | LAXBNTIAOJWAOP-WCGVKTIYSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)[13C]2=[13CH][13CH]=[13CH][13CH]=[13C]2Cl |
Computed by PubChem (NCBI)