CAS 208519-08-8 is the registry number for 3-(3,4-Dimethoxyphenyl)-1h-pyrazol-5-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
5-(3,4-dimethoxyphenyl)-1H-pyrazol-3-amine (CAS 208519-08-8) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-1H-pyrazol-3-amine. InChIKey: UKCBIFQXFFDGHC-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-1H-pyrazol-3-amine |
| InChIKey | UKCBIFQXFFDGHC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=NN2)N)OC |
Computed by PubChem (NCBI)