CAS 208522-13-8 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)hex–5–enoic acid, (S)-N-Boc-2-(3'-butenyl)glycine, Boc-2-(3-Butenyl)-Gly-OH 95%, (S)-2-((tert-Butoxycarbonyl)amino)hex-5-enoic acid, 98%, 98%, (S)-2-((tert-Butoxycarbonyl)amino)hex-5-enoic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 0,025kg, 0,01kg, 5g, 10g, 25g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoic acid (CAS 208522-13-8) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoic acid. InChIKey: LQIMZUPFMSNHTM-QMMMGPOBSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoic acid |
| InChIKey | LQIMZUPFMSNHTM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC=C)C(=O)O |
Computed by PubChem (NCBI)