CAS 2087-45-8 is the registry number for H-Gly-Tyr-oet . hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride (CAS 2087-45-8) is a chemical compound with the molecular formula C13H19ClN2O4 and a molecular weight of 302.75 g/mol. IUPAC name: ethyl (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride. InChIKey: CWTAKWLPWMVYLE-MERQFXBCSA-N.
| Molecular formula | C13H19ClN2O4 |
|---|---|
| Molecular weight | 302.75 g/mol |
| IUPAC name | ethyl (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | CWTAKWLPWMVYLE-MERQFXBCSA-N |
| SMILES | CCOC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)CN.Cl |
Computed by PubChem (NCBI)