Products 865488-39-7
CAS 865488-39-7 appears in our catalog under these names: (R)–4–nitrobenzyl 2–aminohexanoate hydrochloride, (R)-4-Nitrobenzyl 2-Aminohexanoate Hydrochloride, 98%, 98%, (R)-4-nitrobenzyl 2-aminohexanoate hydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(4-nitrophenyl)methyl (2R)-2-aminohexanoate;hydrochloride (CAS 865488-39-7) is a chemical compound with the molecular formula C13H19ClN2O4 and a molecular weight of 302.75 g/mol. IUPAC name: (4-nitrophenyl)methyl (2R)-2-aminohexanoate;hydrochloride. InChIKey: YVEBWECJAWYXFK-UTONKHPSSA-N.
| Molecular formula | C13H19ClN2O4 |
|---|---|
| Molecular weight | 302.75 g/mol |
| IUPAC name | (4-nitrophenyl)methyl (2R)-2-aminohexanoate;hydrochloride |
| InChIKey | YVEBWECJAWYXFK-UTONKHPSSA-N |
| SMILES | CCCC[C@H](C(=O)OCC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)