CAS 92455-59-9 is the registry number for Z–Orn–OH·HCl. Offered by: GLPBio. Available pack sizes: 100g, 25g.
(2S)-5-amino-2-(phenylmethoxycarbonylamino)pentanoic acid;hydrochloride (CAS 92455-59-9) is a chemical compound with the molecular formula C13H19ClN2O4 and a molecular weight of 302.75 g/mol. IUPAC name: (2S)-5-amino-2-(phenylmethoxycarbonylamino)pentanoic acid;hydrochloride. InChIKey: ULELFCUZAINLJV-MERQFXBCSA-N.
| Molecular formula | C13H19ClN2O4 |
|---|---|
| Molecular weight | 302.75 g/mol |
| IUPAC name | (2S)-5-amino-2-(phenylmethoxycarbonylamino)pentanoic acid;hydrochloride |
| InChIKey | ULELFCUZAINLJV-MERQFXBCSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCCN)C(=O)O.Cl |
Computed by PubChem (NCBI)