Products 208718-14-3
CAS 208718-14-3 appears in our catalog under these names: S23757, S-23757, 98%, 2-(2-Fluoro-5-methylphenyl)-4,5-dihydro-1H-imidazole, 98%. Offered by: MedChemExpress, Ambeed, BLDpharm, Chemat. Available pack sizes: 250 mg, 100 mg, 1 g, 100mg, 250mg, 1g.
2-(2-fluoro-5-methylphenyl)-4,5-dihydro-1H-imidazole (CAS 208718-14-3) is a chemical compound with the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. IUPAC name: 2-(2-fluoro-5-methylphenyl)-4,5-dihydro-1H-imidazole. InChIKey: NXWHIOQBGWJKSH-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2 |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 2-(2-fluoro-5-methylphenyl)-4,5-dihydro-1H-imidazole |
| InChIKey | NXWHIOQBGWJKSH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)F)C2=NCCN2 |
Computed by PubChem (NCBI)