Products 2088367-58-0
CAS 2088367-58-0 is the registry number for 5-(TERT-BUTYL)-2-FLUORO-4-HYDROXYBENZONITRILE, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-tert-butyl-2-fluoro-4-hydroxybenzonitrile (CAS 2088367-58-0) is a chemical compound with the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. IUPAC name: 5-tert-butyl-2-fluoro-4-hydroxybenzonitrile. InChIKey: DAWBLSMWCAYGSY-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 5-tert-butyl-2-fluoro-4-hydroxybenzonitrile |
| InChIKey | DAWBLSMWCAYGSY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C(=C1)C#N)F)O |
Computed by PubChem (NCBI)