Products 2088368-59-4
CAS 2088368-59-4 is the registry number for 2-(5-Chloro-2-methoxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-chloro-2-methoxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2088368-59-4) is a chemical compound with the molecular formula C14H20BClO3 and a molecular weight of 282.57 g/mol. IUPAC name: 2-(5-chloro-2-methoxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RVDMPZOZMICYOL-UHFFFAOYSA-N.
| Molecular formula | C14H20BClO3 |
|---|---|
| Molecular weight | 282.57 g/mol |
| IUPAC name | 2-(5-chloro-2-methoxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RVDMPZOZMICYOL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2OC)C)Cl |
Computed by PubChem (NCBI)