Products 2088455-66-5
CAS 2088455-66-5 is the registry number for tert-butyl (2S,4S)-2-[(4-chlorophenyl)methyl]-4-hydroxy-pyrrolidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
Tert-butyl (2S,4S)-2-[(4-chlorophenyl)methyl]-4-hydroxypyrrolidine-1-carboxylate (CAS 2088455-66-5) is a chemical compound with the molecular formula C16H22ClNO3 and a molecular weight of 311.80 g/mol. IUPAC name: tert-butyl (2S,4S)-2-[(4-chlorophenyl)methyl]-4-hydroxypyrrolidine-1-carboxylate. InChIKey: HOMNAZZGWAAIIX-KBPBESRZSA-N.
| Molecular formula | C16H22ClNO3 |
|---|---|
| Molecular weight | 311.80 g/mol |
| IUPAC name | tert-butyl (2S,4S)-2-[(4-chlorophenyl)methyl]-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | HOMNAZZGWAAIIX-KBPBESRZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1CC2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)