Products 2088570-73-2
CAS 2088570-73-2 is the registry number for 5,7-dibromo-2,3-dihydro-1H-inden-4-ol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5,7-dibromo-2,3-dihydro-1H-inden-4-ol (CAS 2088570-73-2) is a chemical compound with the molecular formula C9H8Br2O and a molecular weight of 291.97 g/mol. IUPAC name: 5,7-dibromo-2,3-dihydro-1H-inden-4-ol. InChIKey: PSRWWCYJKAIYGM-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | 5,7-dibromo-2,3-dihydro-1H-inden-4-ol |
| InChIKey | PSRWWCYJKAIYGM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=C(C=C2Br)Br)O |
Computed by PubChem (NCBI)