CAS 2088929-81-9 is the registry number for 6-Fluoro-7-methoxy-2,4-dihydro-1H-3,1-benzoxazine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-fluoro-7-methoxy-1H-3,1-benzoxazine-2,4-dione (CAS 2088929-81-9) is a chemical compound with the molecular formula C9H6FNO4 and a molecular weight of 211.15 g/mol. IUPAC name: 6-fluoro-7-methoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: DKQOXDXHYUHQCT-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO4 |
|---|---|
| Molecular weight | 211.15 g/mol |
| IUPAC name | 6-fluoro-7-methoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | DKQOXDXHYUHQCT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)NC(=O)OC2=O)F |
Computed by PubChem (NCBI)