CAS 258528-35-7 is the registry number for 6-Fluoro-8-nitro-3,4-dihydro-2H-1-benzopyran-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-fluoro-8-nitro-2,3-dihydrochromen-4-one (CAS 258528-35-7) is a chemical compound with the molecular formula C9H6FNO4 and a molecular weight of 211.15 g/mol. IUPAC name: 6-fluoro-8-nitro-2,3-dihydrochromen-4-one. InChIKey: GQTVYGLTUVIQTG-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO4 |
|---|---|
| Molecular weight | 211.15 g/mol |
| IUPAC name | 6-fluoro-8-nitro-2,3-dihydrochromen-4-one |
| InChIKey | GQTVYGLTUVIQTG-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=C(C=C2[N+](=O)[O-])F |
Computed by PubChem (NCBI)