CAS 2089245-85-0 is the registry number for Ethyl (3R)-3-amino-3-(2-chlorophenyl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl (3R)-3-amino-3-(2-chlorophenyl)propanoate;hydrochloride (CAS 2089245-85-0) is a chemical compound with the molecular formula C11H15Cl2NO2 and a molecular weight of 264.14 g/mol. IUPAC name: ethyl (3R)-3-amino-3-(2-chlorophenyl)propanoate;hydrochloride. InChIKey: QGNNIYLULFIWKW-HNCPQSOCSA-N.
| Molecular formula | C11H15Cl2NO2 |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | ethyl (3R)-3-amino-3-(2-chlorophenyl)propanoate;hydrochloride |
| InChIKey | QGNNIYLULFIWKW-HNCPQSOCSA-N |
| SMILES | CCOC(=O)C[C@H](C1=CC=CC=C1Cl)N.Cl |
Computed by PubChem (NCBI)