CAS 2089257-67-8 appears in our catalog under these names: 4-Cyclopropyl-2-fluoroaniline hydrochloride, 98%, 4-Cyclopropyl-2-fluoroaniline hydrochloride, 4-Cyclopropyl-2-fluoroaniline hydrochloride, 97%, 97%, 4-Cyclopropyl-2-fluoroaniline hydrochloride, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 0,5g, 100mg, 250mg, 1g, 500mg.
4-cyclopropyl-2-fluoroaniline;hydrochloride (CAS 2089257-67-8) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: 4-cyclopropyl-2-fluoroaniline;hydrochloride. InChIKey: BSGCFLCMXXNGPC-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | 4-cyclopropyl-2-fluoroaniline;hydrochloride |
| InChIKey | BSGCFLCMXXNGPC-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=C(C=C2)N)F.Cl |
Computed by PubChem (NCBI)