CAS 2089377-02-4 is the registry number for Methyl 5-bromo-4,6-dimethylpicolinate, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-bromo-4,6-dimethylpyridine-2-carboxylate (CAS 2089377-02-4) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: methyl 5-bromo-4,6-dimethylpyridine-2-carboxylate. InChIKey: NCBMKOIKBPWAKM-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | methyl 5-bromo-4,6-dimethylpyridine-2-carboxylate |
| InChIKey | NCBMKOIKBPWAKM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1Br)C)C(=O)OC |
Computed by PubChem (NCBI)