Products 2089648-81-5
CAS 2089648-81-5 is the registry number for Ethyl 4-chloro-7H-pyrrolo(2,3-c)pyridazine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
Ethyl 4-chloro-7H-pyrrolo[2,3-c]pyridazine-3-carboxylate (CAS 2089648-81-5) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 4-chloro-7H-pyrrolo[2,3-c]pyridazine-3-carboxylate. InChIKey: BUVFRWGPQPLJGT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 4-chloro-7H-pyrrolo[2,3-c]pyridazine-3-carboxylate |
| InChIKey | BUVFRWGPQPLJGT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C2C(=C1Cl)C=CN2 |
Computed by PubChem (NCBI)