Products 2089954-50-5
CAS 2089954-50-5 is the registry number for (R)-5-Bromo-8-fluorochromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-5-bromo-8-fluoro-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 2089954-50-5) is a chemical compound with the molecular formula C10H8BrFO3 and a molecular weight of 275.07 g/mol. IUPAC name: (3R)-5-bromo-8-fluoro-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: PFONYZHGHROIRM-RXMQYKEDSA-N.
| Molecular formula | C10H8BrFO3 |
|---|---|
| Molecular weight | 275.07 g/mol |
| IUPAC name | (3R)-5-bromo-8-fluoro-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | PFONYZHGHROIRM-RXMQYKEDSA-N |
| SMILES | C1[C@H](COC2=C(C=CC(=C21)Br)F)C(=O)O |
Computed by PubChem (NCBI)