Products 2090266-00-3
CAS 2090266-00-3 is the registry number for 4-(Chloromethyl)-1-(cyclopropylmethyl)-3-(trifluoromethyl)-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 1000mg.
4-(chloromethyl)-1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazole (CAS 2090266-00-3) is a chemical compound with the molecular formula C9H10ClF3N2 and a molecular weight of 238.64 g/mol. IUPAC name: 4-(chloromethyl)-1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazole. InChIKey: KCLLYLWGHUIRQS-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF3N2 |
|---|---|
| Molecular weight | 238.64 g/mol |
| IUPAC name | 4-(chloromethyl)-1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazole |
| InChIKey | KCLLYLWGHUIRQS-UHFFFAOYSA-N |
| SMILES | C1CC1CN2C=C(C(=N2)C(F)(F)F)CCl |
Computed by PubChem (NCBI)