Products 2090584-46-4
CAS 2090584-46-4 appears in our catalog under these names: 1-(Cyclopropylmethyl)-3-(trifluoromethyl)-1h-pyrazole-5-carboxylic acid, 95%, 1-(Cyclopropylmethyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid (CAS 2090584-46-4) is a chemical compound with the molecular formula C9H9F3N2O2 and a molecular weight of 234.17 g/mol. IUPAC name: 1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid. InChIKey: TZFHRHBRLUBVIV-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O2 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
| InChIKey | TZFHRHBRLUBVIV-UHFFFAOYSA-N |
| SMILES | C1CC1CN2C(=CC(=N2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)