CAS 54672-09-2 appears in our catalog under these names: N,N-Dimethyl-4-nitro-2-(trifluoromethyl)aniline, 98%, N,N-Dimethyl-4-nitro-2-(trifluoromethyl)aniline, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 5g, 1g, 10g.
N,N-dimethyl-4-nitro-2-(trifluoromethyl)aniline (CAS 54672-09-2) is a chemical compound with the molecular formula C9H9F3N2O2 and a molecular weight of 234.17 g/mol. IUPAC name: N,N-dimethyl-4-nitro-2-(trifluoromethyl)aniline. InChIKey: OIZCWRMHLSZGKT-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O2 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | N,N-dimethyl-4-nitro-2-(trifluoromethyl)aniline |
| InChIKey | OIZCWRMHLSZGKT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)