CAS 307557-56-8 is the registry number for 2-[3-(Trifluoromethyl)phenoxy]acetohydrazide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
2-[3-(trifluoromethyl)phenoxy]acetohydrazide (CAS 307557-56-8) is a chemical compound with the molecular formula C9H9F3N2O2 and a molecular weight of 234.17 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenoxy]acetohydrazide. InChIKey: CVXTVRVYODCHAX-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O2 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenoxy]acetohydrazide |
| InChIKey | CVXTVRVYODCHAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)NN)C(F)(F)F |
Computed by PubChem (NCBI)