CAS 40700-38-7 is the registry number for N,N-Dimethyl-2-nitro-4-(trifluoromethyl)aniline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
N,N-dimethyl-2-nitro-4-(trifluoromethyl)aniline (CAS 40700-38-7) is a chemical compound with the molecular formula C9H9F3N2O2 and a molecular weight of 234.17 g/mol. IUPAC name: N,N-dimethyl-2-nitro-4-(trifluoromethyl)aniline. InChIKey: FDGCMYGPTQRTMZ-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O2 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | N,N-dimethyl-2-nitro-4-(trifluoromethyl)aniline |
| InChIKey | FDGCMYGPTQRTMZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)