Products 2090590-64-8
CAS 2090590-64-8 is the registry number for 1-(1-(2,6-Dimethylphenyl)-1H-pyrazol-5-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[2-(2,6-dimethylphenyl)pyrazol-3-yl]ethanone (CAS 2090590-64-8) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: 1-[2-(2,6-dimethylphenyl)pyrazol-3-yl]ethanone. InChIKey: XKCKWLLLROUVQD-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 1-[2-(2,6-dimethylphenyl)pyrazol-3-yl]ethanone |
| InChIKey | XKCKWLLLROUVQD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N2C(=CC=N2)C(=O)C |
Computed by PubChem (NCBI)