CAS 2090832-20-3 appears in our catalog under these names: 1-(4-Methylphenyl)-d-proline, 95%, 1–(4–Methylphenyl)–D–proline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(2R)-1-(4-methylphenyl)pyrrolidine-2-carboxylic acid (CAS 2090832-20-3) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (2R)-1-(4-methylphenyl)pyrrolidine-2-carboxylic acid. InChIKey: YDQNTBQBTVUYIG-LLVKDONJSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | (2R)-1-(4-methylphenyl)pyrrolidine-2-carboxylic acid |
| InChIKey | YDQNTBQBTVUYIG-LLVKDONJSA-N |
| SMILES | CC1=CC=C(C=C1)N2CCC[C@@H]2C(=O)O |
Computed by PubChem (NCBI)