CAS 2090933-06-3 appears in our catalog under these names: 7-Bromo-1,6-dimethyl-1H-indazole, 97%, 7-bromo-1,6-dimethyl-indazole, 97%, 97%, 7-Bromo-1,6-dimethyl-indazole, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g, 25g.
7-bromo-1,6-dimethylindazole (CAS 2090933-06-3) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 7-bromo-1,6-dimethylindazole. InChIKey: HWIRPUMMASRCRK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 7-bromo-1,6-dimethylindazole |
| InChIKey | HWIRPUMMASRCRK-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C=NN2C)Br |
Computed by PubChem (NCBI)