Products 2091182-77-1
CAS 2091182-77-1 is the registry number for 6-Bromo-3,3-dimethyl-3,4-dihydroisoquinolin-1(2H)-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-bromo-3,3-dimethyl-2,4-dihydroisoquinolin-1-one (CAS 2091182-77-1) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 6-bromo-3,3-dimethyl-2,4-dihydroisoquinolin-1-one. InChIKey: OIXRTVJUXOGARN-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 6-bromo-3,3-dimethyl-2,4-dihydroisoquinolin-1-one |
| InChIKey | OIXRTVJUXOGARN-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C=CC(=C2)Br)C(=O)N1)C |
Computed by PubChem (NCBI)