Products 2091417-05-7
CAS 2091417-05-7 is the registry number for tert-Butyl 7-amino-5-azaspiro(2.5)octane-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 7-amino-5-azaspiro[2.5]octane-5-carboxylate (CAS 2091417-05-7) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 7-amino-5-azaspiro[2.5]octane-5-carboxylate. InChIKey: CPDWBPQOHGRGQS-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 7-amino-5-azaspiro[2.5]octane-5-carboxylate |
| InChIKey | CPDWBPQOHGRGQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CC2(C1)CC2)N |
Computed by PubChem (NCBI)