Products 2091447-00-4
CAS 2091447-00-4 is the registry number for 1-Methyl-3-(1,3-oxazol-2-yl)-1H-pyrazole-5-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
1-methyl-3-(1,3-oxazol-2-yl)pyrazole-5-carboxylic acid (CAS 2091447-00-4) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 1-methyl-3-(1,3-oxazol-2-yl)pyrazole-5-carboxylic acid. InChIKey: MHASUMCRYLUCGW-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 1-methyl-3-(1,3-oxazol-2-yl)pyrazole-5-carboxylic acid |
| InChIKey | MHASUMCRYLUCGW-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=NC=CO2)C(=O)O |
Computed by PubChem (NCBI)