CAS 2091521-95-6 is the registry number for Methyl 2-chloro-1,6-naphthyridine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chloro-1,6-naphthyridine-3-carboxylate (CAS 2091521-95-6) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: methyl 2-chloro-1,6-naphthyridine-3-carboxylate. InChIKey: XZNFEQLYHYCZIE-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | methyl 2-chloro-1,6-naphthyridine-3-carboxylate |
| InChIKey | XZNFEQLYHYCZIE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C2C=CN=CC2=C1)Cl |
Computed by PubChem (NCBI)