Products 2091528-24-2
CAS 2091528-24-2 is the registry number for Ethyl 3-bromo-1h-pyrrolo[3,2-b]pyridine-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-5-carboxylate (CAS 2091528-24-2) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-5-carboxylate. InChIKey: CWNXRXNBTJCJOR-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 3-bromo-1H-pyrrolo[3,2-b]pyridine-5-carboxylate |
| InChIKey | CWNXRXNBTJCJOR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=C1)NC=C2Br |
Computed by PubChem (NCBI)