CAS 2091710-34-6 is the registry number for Methyl 3-chloro-5H,6H,7H-cyclopenta(C)pyridazine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 3-chloro-6,7-dihydro-5H-cyclopenta[c]pyridazine-4-carboxylate (CAS 2091710-34-6) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: methyl 3-chloro-6,7-dihydro-5H-cyclopenta[c]pyridazine-4-carboxylate. InChIKey: RZDZFVGCJDGSLT-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | methyl 3-chloro-6,7-dihydro-5H-cyclopenta[c]pyridazine-4-carboxylate |
| InChIKey | RZDZFVGCJDGSLT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=NC2=C1CCC2)Cl |
Computed by PubChem (NCBI)