CAS 2091951-36-7 is the registry number for 4-(3-Amino-4-methylphenyl)benzonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(3-amino-4-methylphenyl)benzonitrile (CAS 2091951-36-7) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 4-(3-amino-4-methylphenyl)benzonitrile. InChIKey: LDCWAFBPLDFJDR-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4-(3-amino-4-methylphenyl)benzonitrile |
| InChIKey | LDCWAFBPLDFJDR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=C(C=C2)C#N)N |
Computed by PubChem (NCBI)