CAS 209225-06-9 is the registry number for Methyl 4-bromo-2,3-dihydro-1H-indene-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-bromo-2,3-dihydro-1H-indene-2-carboxylate (CAS 209225-06-9) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: methyl 4-bromo-2,3-dihydro-1H-indene-2-carboxylate. InChIKey: JDCDSNNAIZPDGQ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | methyl 4-bromo-2,3-dihydro-1H-indene-2-carboxylate |
| InChIKey | JDCDSNNAIZPDGQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(C1)C(=CC=C2)Br |
Computed by PubChem (NCBI)