Products 2092478-39-0
CAS 2092478-39-0 is the registry number for ethyl 5-bromo-1H-indole-4-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Ethyl 5-bromo-1H-indole-4-carboxylate (CAS 2092478-39-0) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: ethyl 5-bromo-1H-indole-4-carboxylate. InChIKey: LYMUUPOKQVPAOF-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | ethyl 5-bromo-1H-indole-4-carboxylate |
| InChIKey | LYMUUPOKQVPAOF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC2=C1C=CN2)Br |
Computed by PubChem (NCBI)