Products 71471-40-4
CAS 71471-40-4 appears in our catalog under these names: (4-Bromophenyl)succinic acid, (4-Bromophenyl)succinic acid, 95%, 2-(4-Bromophenyl)succinic acid, 2-(4-Bromophenyl)succinic acid, 98%, 2-(4-Bromophenyl)succinic acid, 95%. Offered by: Chemat, Combi-blocks, Biosynth, AmBeed, Fluorochem. Available pack sizes: 200mg, 1g, 50mg, 5g, 250mg.
2-(4-bromophenyl)butanedioic acid (CAS 71471-40-4) is a chemical compound with the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. IUPAC name: 2-(4-bromophenyl)butanedioic acid. InChIKey: OVOOMMVRUQGTIQ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO4 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | 2-(4-bromophenyl)butanedioic acid |
| InChIKey | OVOOMMVRUQGTIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)C(=O)O)Br |
Computed by PubChem (NCBI)