Products 2092867-73-5
CAS 2092867-73-5 is the registry number for Methyl 5-bromo-2-fluoro-3-(trifluoromethyl)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
Methyl 5-bromo-2-fluoro-3-(trifluoromethyl)benzoate (CAS 2092867-73-5) is a chemical compound with the molecular formula C9H5BrF4O2 and a molecular weight of 301.03 g/mol. IUPAC name: methyl 5-bromo-2-fluoro-3-(trifluoromethyl)benzoate. InChIKey: FCOLNLYOIPUVNA-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF4O2 |
|---|---|
| Molecular weight | 301.03 g/mol |
| IUPAC name | methyl 5-bromo-2-fluoro-3-(trifluoromethyl)benzoate |
| InChIKey | FCOLNLYOIPUVNA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Br)C(F)(F)F)F |
Computed by PubChem (NCBI)