Products 2093221-12-4
CAS 2093221-12-4 appears in our catalog under these names: 3-Fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98%, 98%, 3-Fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
3-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2093221-12-4) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: 3-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: LBRCEMHFDCIHDD-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 3-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | LBRCEMHFDCIHDD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2C)F)C(=O)O |
Computed by PubChem (NCBI)