CAS 2093452-30-1 appears in our catalog under these names: Rel-(2R,4R)-2-methyl-4-(trifluoromethyl)piperidine hydrochloride, 97%, 97%, RAC-(2R,4R)-2-METHYL-4-(TRIFLUOROMETHYL)PIPERIDINE HYDROCHLORIDE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(2R,4R)-2-methyl-4-(trifluoromethyl)piperidine;hydrochloride (CAS 2093452-30-1) is a chemical compound with the molecular formula C7H13ClF3N and a molecular weight of 203.63 g/mol. IUPAC name: (2R,4R)-2-methyl-4-(trifluoromethyl)piperidine;hydrochloride. InChIKey: QOZJPAWGCPJPRP-KGZKBUQUSA-N.
| Molecular formula | C7H13ClF3N |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | (2R,4R)-2-methyl-4-(trifluoromethyl)piperidine;hydrochloride |
| InChIKey | QOZJPAWGCPJPRP-KGZKBUQUSA-N |
| SMILES | C[C@@H]1C[C@@H](CCN1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)