CAS 30933-74-5 appears in our catalog under these names: cis-3-(trifluoromethyl)cyclohexan-1-amine hydrochloride, 98%, rac-(1R,3S)-3-(Trifluoromethyl)cyclohexan-1-amine hydrochloride, rac-(1R,3S)-3-(trifluoromethyl)cyclohexan-1-amine hydrochloride, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 0,5g, 50mg, 100mg, 250mg, 500mg.
Cis-(1R,3S)-3-(trifluoromethyl)cyclohexan-1-amine;hydrochloride (CAS 30933-74-5) is a chemical compound with the molecular formula C7H13ClF3N and a molecular weight of 203.63 g/mol. IUPAC name: cis-(1R,3S)-3-(trifluoromethyl)cyclohexan-1-amine;hydrochloride. InChIKey: RCSIEAABDZVSPX-RIHPBJNCSA-N.
| Molecular formula | C7H13ClF3N |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | cis-(1R,3S)-3-(trifluoromethyl)cyclohexan-1-amine;hydrochloride |
| InChIKey | RCSIEAABDZVSPX-RIHPBJNCSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)