Products 2769927-22-0
CAS 2769927-22-0 is the registry number for (S)-7,7,7-Trifluorohept-1-en-4-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-7,7,7-trifluorohept-1-en-4-amine;hydrochloride (CAS 2769927-22-0) is a chemical compound with the molecular formula C7H13ClF3N and a molecular weight of 203.63 g/mol. IUPAC name: (4S)-7,7,7-trifluorohept-1-en-4-amine;hydrochloride. InChIKey: JHAGWPBBJXYSBE-FYZOBXCZSA-N.
| Molecular formula | C7H13ClF3N |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | (4S)-7,7,7-trifluorohept-1-en-4-amine;hydrochloride |
| InChIKey | JHAGWPBBJXYSBE-FYZOBXCZSA-N |
| SMILES | C=CC[C@H](CCC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)