CAS 2089671-23-6 appears in our catalog under these names: (R)-1-CYCLOPENTYL-2,2,2-TRIFLUOROETHAN-1-AMINE HCL, 95%, (R)-1-Cyclopentyl-2,2,2-trifluoroethan-1-amine hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 500mg.
(1R)-1-cyclopentyl-2,2,2-trifluoroethanamine;hydrochloride (CAS 2089671-23-6) is a chemical compound with the molecular formula C7H13ClF3N and a molecular weight of 203.63 g/mol. IUPAC name: (1R)-1-cyclopentyl-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: KUXNOAUBDNRTEA-FYZOBXCZSA-N.
| Molecular formula | C7H13ClF3N |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | (1R)-1-cyclopentyl-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | KUXNOAUBDNRTEA-FYZOBXCZSA-N |
| SMILES | C1CCC(C1)[C@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)