CAS 2094-73-7 appears in our catalog under these names: Ethyl 1-Adamantanecarboxylate, Ethyl 1–Adamantanecarboxylate, Ethyl 1-Adamantanecarboxylate, >98.0%(GC), Ethyl adamantane-1-carboxylate 98%, Ethyl adamantane-1-carboxylate, 98%, 98%. Offered by: Chemat Brand, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: on request, 100g, 25g, 5g, 500g, 50g.
Ethyl adamantane-1-carboxylate (CAS 2094-73-7) is a chemical compound with the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. IUPAC name: ethyl adamantane-1-carboxylate. InChIKey: SYEXGNJRYPOUSI-UHFFFAOYSA-N.
| Molecular formula | C13H20O2 |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | ethyl adamantane-1-carboxylate |
| InChIKey | SYEXGNJRYPOUSI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)