CAS 2094020-19-4 appears in our catalog under these names: (2R,4R,6S)-2,6-dimethylpiperidine-4-carboxylic acid hydrochloride, 95%, rac-(2R,4R,6S)-2,6-Dimethylpiperidine-4-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 50mg, 0,5g.
(2R,6S)-2,6-dimethylpiperidine-4-carboxylic acid;hydrochloride (CAS 2094020-19-4) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: (2R,6S)-2,6-dimethylpiperidine-4-carboxylic acid;hydrochloride. InChIKey: NDFWKHGECKXNKR-VPEOJXMDSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | (2R,6S)-2,6-dimethylpiperidine-4-carboxylic acid;hydrochloride |
| InChIKey | NDFWKHGECKXNKR-VPEOJXMDSA-N |
| SMILES | C[C@@H]1CC(C[C@@H](N1)C)C(=O)O.Cl |
Computed by PubChem (NCBI)