CAS 2094034-16-7 is the registry number for rac-(1S,3S)-3-Amino-3-phenylcyclobutan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-amino-3-phenylcyclobutan-1-ol;hydrochloride (CAS 2094034-16-7) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 3-amino-3-phenylcyclobutan-1-ol;hydrochloride. InChIKey: RXOVUERNTXNPJG-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 3-amino-3-phenylcyclobutan-1-ol;hydrochloride |
| InChIKey | RXOVUERNTXNPJG-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C2=CC=CC=C2)N)O.Cl |
Computed by PubChem (NCBI)