Products 2094856-03-6

CAS 2094856-03-6 is the registry number for 2-((2-Oxo-1,2-dihydropyridin-4-yl)methoxy)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[(2-oxo-1H-pyridin-4-yl)methoxy]acetic acid (CAS 2094856-03-6) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 2-[(2-oxo-1H-pyridin-4-yl)methoxy]acetic acid. InChIKey: AQOUKZUJYJAOQF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO4
Molecular weight183.16 g/mol
IUPAC name2-[(2-oxo-1H-pyridin-4-yl)methoxy]acetic acid
InChIKeyAQOUKZUJYJAOQF-UHFFFAOYSA-N
SMILESC1=CNC(=O)C=C1COCC(=O)O

Computed by PubChem (NCBI)