Products 2095417-49-3
CAS 2095417-49-3 is the registry number for 3’-Deoxy-5-methoxyuridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione (CAS 2095417-49-3) is a chemical compound with the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. IUPAC name: 1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione. InChIKey: QAOLFGCSNYUCSI-CCGCGBOQSA-N.
| Molecular formula | C10H14N2O6 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione |
| InChIKey | QAOLFGCSNYUCSI-CCGCGBOQSA-N |
| SMILES | COC1=CN(C(=O)NC1=O)[C@H]2[C@@H](C[C@H](O2)CO)O |
Computed by PubChem (NCBI)
Synonyms:
3'-Deoxy-5-methoxyuridine, orb1908726