CAS 2095636-19-2 is the registry number for Antituberculosis agent-10. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5S)-5-(aminomethyl)-3-[3-fluoro-4-(4-methylsulfonylphenyl)phenyl]-1,3-oxazolidin-2-one (CAS 2095636-19-2) is a chemical compound with the molecular formula C17H17FN2O4S and a molecular weight of 364.4 g/mol. IUPAC name: (5S)-5-(aminomethyl)-3-[3-fluoro-4-(4-methylsulfonylphenyl)phenyl]-1,3-oxazolidin-2-one. InChIKey: GKKCWYDKVOUUMW-ZDUSSCGKSA-N.
| Molecular formula | C17H17FN2O4S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | (5S)-5-(aminomethyl)-3-[3-fluoro-4-(4-methylsulfonylphenyl)phenyl]-1,3-oxazolidin-2-one |
| InChIKey | GKKCWYDKVOUUMW-ZDUSSCGKSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=C(C=C(C=C2)N3C[C@@H](OC3=O)CN)F |
Computed by PubChem (NCBI)