CAS 945966-46-1 appears in our catalog under these names: Apararenone (MT–3995), Apararenone, 95%, Apararenone/ 99.65% (existing batch purity), N-(4-(4-Fluorophenyl)-2,2-dimethyl-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-7-yl)methanesulfonamide, 97%, 97%, Apararenone, 99.09%. Offered by: GLPBio, Combi-blocks, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 100mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 5 mg.
N-[4-(4-fluorophenyl)-2,2-dimethyl-3-oxo-1,4-benzoxazin-7-yl]methanesulfonamide (CAS 945966-46-1) is a chemical compound with the molecular formula C17H17FN2O4S and a molecular weight of 364.4 g/mol. IUPAC name: N-[4-(4-fluorophenyl)-2,2-dimethyl-3-oxo-1,4-benzoxazin-7-yl]methanesulfonamide. InChIKey: AZNHWXAFPBYFGH-UHFFFAOYSA-N.
| Molecular formula | C17H17FN2O4S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | N-[4-(4-fluorophenyl)-2,2-dimethyl-3-oxo-1,4-benzoxazin-7-yl]methanesulfonamide |
| InChIKey | AZNHWXAFPBYFGH-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C2=C(O1)C=C(C=C2)NS(=O)(=O)C)C3=CC=C(C=C3)F)C |
Computed by PubChem (NCBI)