Products 438029-79-9

CAS 438029-79-9 is the registry number for 3-[4-(4-Fluoro-phenyl)-piperazine-1-sulfonyl]-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoic acid (CAS 438029-79-9) is a chemical compound with the molecular formula C17H17FN2O4S and a molecular weight of 364.4 g/mol. IUPAC name: 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoic acid. InChIKey: ARVDWLWJSODXRD-UHFFFAOYSA-N.

Identity
Molecular formulaC17H17FN2O4S
Molecular weight364.4 g/mol
IUPAC name3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoic acid
InChIKeyARVDWLWJSODXRD-UHFFFAOYSA-N
SMILESC1CN(CCN1C2=CC=C(C=C2)F)S(=O)(=O)C3=CC=CC(=C3)C(=O)O

Computed by PubChem (NCBI)