CAS 438029-79-9 is the registry number for 3-[4-(4-Fluoro-phenyl)-piperazine-1-sulfonyl]-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoic acid (CAS 438029-79-9) is a chemical compound with the molecular formula C17H17FN2O4S and a molecular weight of 364.4 g/mol. IUPAC name: 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoic acid. InChIKey: ARVDWLWJSODXRD-UHFFFAOYSA-N.
| Molecular formula | C17H17FN2O4S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylbenzoic acid |
| InChIKey | ARVDWLWJSODXRD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)F)S(=O)(=O)C3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)